ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
| Ürün Adı |
3,5-Dibromo-4-methylphenol |
| Eş anlamlı |
3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
| Moleküler Formülü |
C7H6Br2O |
| Molekül Ağırlığı |
265.9299 |
| InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
| CAS kayıt numarası |
13979-81-2 |
| EINECS |
237-763-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.948g/cm3 |
| Kaynama noktası |
293.1°C at 760 mmHg |
| Kırılma indisi |
1.626 |
| Alevlenme noktası |
131.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
