ChemNet > CAS > 1475-13-4 2,4-Dichloro-Alpha-methylbenzyl alcohol
1475-13-4 2,4-Dichloro-Alpha-methylbenzyl alcohol
| Ürün Adı |
2,4-Dichloro-Alpha-methylbenzyl alcohol |
| Eş anlamlı |
Benzyl alcohol, 2,4-dichloro-alpha-methyl-; 1-(2,4-dichlorophenyl)ethanol; (1S)-1-(2,4-dichlorophenyl)ethanol; (1R)-1-(2,4-dichlorophenyl)ethanol; 2,4-Dichloro-a-methylbenzyl alcohol |
| Moleküler Formülü |
C8H8Cl2O |
| Molekül Ağırlığı |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5,11H,1H3/t5-/m1/s1 |
| CAS kayıt numarası |
1475-13-4 |
| EINECS |
216-019-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.323g/cm3 |
| Kaynama noktası |
270.7°C at 760 mmHg |
| Kırılma indisi |
1.566 |
| Alevlenme noktası |
115.6°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
