ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
Ürün Adı |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
Eş anlamlı |
2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
Moleküler Formülü |
C6H2BF5O2 |
Molekül Ağırlığı |
211.8819 |
InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
CAS kayıt numarası |
1582-24-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.61g/cm3 |
Kaynama noktası |
244°C at 760 mmHg |
Kırılma indisi |
1.429 |
Alevlenme noktası |
101.4°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|