ChemNet > CAS > 177787-26-7 3,4,5-trifluorobenzoyl chloride
177787-26-7 3,4,5-trifluorobenzoyl chloride
Ürün Adı |
3,4,5-trifluorobenzoyl chloride |
Moleküler Formülü |
C7H2ClF3O |
Molekül Ağırlığı |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-4(9)6(11)5(10)2-3/h1-2H |
CAS kayıt numarası |
177787-26-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.514g/cm3 |
Kaynama noktası |
184.7°C at 760 mmHg |
Kırılma indisi |
1.479 |
Alevlenme noktası |
65.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|