ChemNet > CAS > 179113-89-4 3,5-difluorobenzophenone
179113-89-4 3,5-difluorobenzophenone
| Ürün Adı |
3,5-difluorobenzophenone |
| Eş anlamlı |
(3,5-difluorophenyl)(phenyl)methanone |
| Moleküler Formülü |
C13H8F2O |
| Molekül Ağırlığı |
218.1988 |
| InChI |
InChI=1/C13H8F2O/c14-11-6-10(7-12(15)8-11)13(16)9-4-2-1-3-5-9/h1-8H |
| CAS kayıt numarası |
179113-89-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.239g/cm3 |
| Ergime noktası |
57-59℃ |
| Kaynama noktası |
310°C at 760 mmHg |
| Kırılma indisi |
1.549 |
| Alevlenme noktası |
118.9°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
