ChemNet > CAS > 219492-12-3 3-(Benzyloxy)-4-methylphenylamine
219492-12-3 3-(Benzyloxy)-4-methylphenylamine
| Ürün Adı |
3-(Benzyloxy)-4-methylphenylamine |
| Eş anlamlı |
3-(benzyloxy)-4-methylaniline |
| Moleküler Formülü |
C14H15NO |
| Molekül Ağırlığı |
213.275 |
| InChI |
InChI=1/C14H15NO/c1-11-7-8-13(15)9-14(11)16-10-12-5-3-2-4-6-12/h2-9H,10,15H2,1H3 |
| CAS kayıt numarası |
219492-12-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.106g/cm3 |
| Kaynama noktası |
369.3°C at 760 mmHg |
| Kırılma indisi |
1.606 |
| Alevlenme noktası |
184.1°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
