ChemNet > CAS > 2396-85-2 methyl trans-2-octenoate
2396-85-2 methyl trans-2-octenoate
Ürün Adı |
methyl trans-2-octenoate |
Eş anlamlı |
219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
Moleküler Formülü |
C9H16O2 |
Molekül Ağırlığı |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
CAS kayıt numarası |
2396-85-2 |
EINECS |
219-259-8 |
Moleküler Yapısı |
|
Yoğunluk |
0.896g/cm3 |
Kaynama noktası |
194.6°C at 760 mmHg |
Kırılma indisi |
1.436 |
Alevlenme noktası |
82.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|