ChemNet > CAS > 261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride
| Ürün Adı |
2,6-Difluoro-3-methylbenzoyl chloride |
| Eş anlamlı |
2,6-Difluoro-m-toluoyl chloride |
| Moleküler Formülü |
C8H5ClF2O |
| Molekül Ağırlığı |
190.5745 |
| InChI |
InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
| CAS kayıt numarası |
261763-39-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.356g/cm3 |
| Kaynama noktası |
203.1°C at 760 mmHg |
| Kırılma indisi |
1.499 |
| Alevlenme noktası |
76.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
