ChemNet > CAS > 261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride
Ürün Adı |
2,6-Difluoro-3-methylbenzoyl chloride |
Eş anlamlı |
2,6-Difluoro-m-toluoyl chloride |
Moleküler Formülü |
C8H5ClF2O |
Molekül Ağırlığı |
190.5745 |
InChI |
InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
CAS kayıt numarası |
261763-39-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.356g/cm3 |
Kaynama noktası |
203.1°C at 760 mmHg |
Kırılma indisi |
1.499 |
Alevlenme noktası |
76.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|