ChemNet > CAS > 27193-86-8 4-Dodecylphenol, mixture of isomers
27193-86-8 4-Dodecylphenol, mixture of isomers
| Ürün Adı |
4-Dodecylphenol, mixture of isomers |
| Eş anlamlı |
Dodecylphenol, mixture of isomers; 2-dodecylphenol |
| Moleküler Formülü |
C18H30O |
| Molekül Ağırlığı |
262.4302 |
| InChI |
InChI=1/C18H30O/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19/h12-13,15-16,19H,2-11,14H2,1H3 |
| CAS kayıt numarası |
27193-86-8 |
| EINECS |
248-312-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.918g/cm3 |
| Kaynama noktası |
368.3°C at 760 mmHg |
| Kırılma indisi |
1.499 |
| Alevlenme noktası |
210.8°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
