ChemNet > CAS > 2757-23-5 chlorocarbonylsulfenyl chloride
2757-23-5 chlorocarbonylsulfenyl chloride
| Ürün Adı |
chlorocarbonylsulfenyl chloride |
| Eş anlamlı |
Chloro(chlorosulfanyl)oxomethane; Methane, chloro(chlorothio)oxo- |
| Moleküler Formülü |
CCl2OS |
| Molekül Ağırlığı |
130.9811 |
| InChI |
InChI=1/CCl2OS/c2-1(4)5-3 |
| CAS kayıt numarası |
2757-23-5 |
| EINECS |
220-415-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.66g/cm3 |
| Kaynama noktası |
98°C at 760 mmHg |
| Kırılma indisi |
1.53 |
| Alevlenme noktası |
53.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
