ChemNet > CAS > 3289-28-9 Ethyl Cyclohexanecarboxylate
3289-28-9 Ethyl Cyclohexanecarboxylate
Ürün Adı |
Ethyl Cyclohexanecarboxylate |
Eş anlamlı |
Cyclohexanecarboxylic acid ethyl ester; Ethyl cyclohexane carboxylate |
Moleküler Formülü |
C9H16O2 |
Molekül Ağırlığı |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-2-11-9(10)8-6-4-3-5-7-8/h8H,2-7H2,1H3 |
CAS kayıt numarası |
3289-28-9 |
EINECS |
221-945-7 |
Moleküler Yapısı |
|
Yoğunluk |
0.972g/cm3 |
Kaynama noktası |
197.1°C at 760 mmHg |
Kırılma indisi |
1.451 |
Alevlenme noktası |
68.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|