ChemNet > CAS > 4593-90-2 (+/-)-3-phenylbutyric acid
4593-90-2 (+/-)-3-phenylbutyric acid
| Ürün Adı |
(+/-)-3-phenylbutyric acid |
| Eş anlamlı |
3-Phenylbutyric acid; 3-phenylbutanoic acid |
| Moleküler Formülü |
C10H12O2 |
| Molekül Ağırlığı |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
| CAS kayıt numarası |
4593-90-2 |
| EINECS |
224-987-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.09g/cm3 |
| Ergime noktası |
35-38℃ |
| Kaynama noktası |
288°C at 760 mmHg |
| Kırılma indisi |
1.531 |
| Alevlenme noktası |
170.2°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
