ChemNet > CAS > 465514-59-4 1-(2,6-difluorophenyl)-2-phenyl-1-ethanone
465514-59-4 1-(2,6-difluorophenyl)-2-phenyl-1-ethanone
Ürün Adı |
1-(2,6-difluorophenyl)-2-phenyl-1-ethanone |
Eş anlamlı |
1-(2,6-difluorophenyl)-2-phenylethanone |
Moleküler Formülü |
C14H10F2O |
Molekül Ağırlığı |
232.2254 |
InChI |
InChI=1/C14H10F2O/c15-11-7-4-8-12(16)14(11)13(17)9-10-5-2-1-3-6-10/h1-8H,9H2 |
CAS kayıt numarası |
465514-59-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.221g/cm3 |
Kaynama noktası |
317.6°C at 760 mmHg |
Kırılma indisi |
1.552 |
Alevlenme noktası |
121.8°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|