ChemNet > CAS > 51163-27-0 3,4-dimethylphenyl isocyanate
51163-27-0 3,4-dimethylphenyl isocyanate
| Ürün Adı |
3,4-dimethylphenyl isocyanate |
| Eş anlamlı |
4-isocyanato-1,2-dimethylbenzene |
| Moleküler Formülü |
C9H9NO |
| Molekül Ağırlığı |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-7-3-4-9(10-6-11)5-8(7)2/h3-5H,1-2H3 |
| CAS kayıt numarası |
51163-27-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.98g/cm3 |
| Kaynama noktası |
229.9°C at 760 mmHg |
| Kırılma indisi |
1.515 |
| Alevlenme noktası |
81.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
