ChemNet > CAS > 5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
Ürün Adı |
Methyl 3-methoxy-2-nitrobenzoate |
Eş anlamlı |
3-Methoxy-2-nitrobenzoic acid methyl ester; 3-Methoxy-2-nitromethylbenzoate |
Moleküler Formülü |
C9H9NO5 |
Molekül Ağırlığı |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-14-7-5-3-4-6(9(11)15-2)8(7)10(12)13/h3-5H,1-2H3 |
CAS kayıt numarası |
5307-17-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.294g/cm3 |
Kaynama noktası |
325.4°C at 760 mmHg |
Kırılma indisi |
1.54 |
Alevlenme noktası |
151.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|