ChemNet > CAS > 53723-88-9 (5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid
53723-88-9 (5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid
| Ürün Adı |
(5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid |
| Eş anlamlı |
2-[(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid; [(5-thioxo-4,5-dihydro-1,3,4-thiadiazol-2-yl)sulfanyl]acetate; [(5-thioxo-4,5-dihydro-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid; [(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid |
| Moleküler Formülü |
C4H4N2O2S3 |
| Molekül Ağırlığı |
208.2818 |
| InChI |
InChI=1/C4H4N2O2S3/c7-2(8)1-10-4-6-5-3(9)11-4/h1H2,(H,5,9)(H,7,8) |
| CAS kayıt numarası |
53723-88-9 |
| EINECS |
258-728-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.89g/cm3 |
| Ergime noktası |
158-160℃ |
| Kaynama noktası |
380.6°C at 760 mmHg |
| Kırılma indisi |
1.85 |
| Alevlenme noktası |
184°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S36:Wear suitable protective clothing.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
