Ürün Adı |
D-Glusitol, etoksillenmiş ve propoksillenmiş (1 - 12.5 mol etoksillenmiş ve 1 - 12.5 mol propoksillenmiş) |
Eş anlamlı |
Polioksietilen (245), polioksipropilen (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polioksietilen (500), polioksipropilen (6), sorbitol; Polioksipropilen (6), polioksietilen (245) sorbitol; Polioksipropilen (6), polioksietilen (500) sorbitol; Poli (oksi (metil-1,2-etandiil) oksi-1,2-etandiil), D-glusitol; Oksiran, 2-metil-, oksiranlı polimer, D-glusitollü eter (6:1); Oksiran, metil-, oksiranlı polimer, D-glusitollü eter (6:1); (2R,3R,4R,5S)-heksan-1,2,3,4,5,6-heksol; 2-metiloksiran; oksiran;
|
ingilizce adı |
D-Glucitol, ethoxylated and propoxylated (1 - 12.5 moles ethoxylated and 1 - 12.5 moles propoxylated);Polyoxyethylene (245) polyoxypropylene (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polyoxyethylene (500) polyoxypropylene (6) sorbitol; Polyoxypropylene (6) polyoxyethylene (245) sorbitol; Polyoxypropylene (6) polyoxyethylene (500) sorbitol; Poly(oxy(methyl-1,2-ethanediyl)oxy-1,2-ethanediyl), D-glucitol; Oxirane, 2-methyl-, polymer with oxirane, ether with D-glucitol (6:1); Oxirane, methyl-, polymer with oxirane, ether with D-glucitol (6:1); (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol; 2-methyloxirane; oxirane |
Moleküler Formülü |
C36H74O18 |
Molekül Ağırlığı |
794.962 |
InChI |
InChI=1/C6H14O6.6C3H6O.6C2H4O/c7-1-3(9)5(11)6(12)4(10)2-8;6*1-3-2-4-3;6*1-2-3-1/h3-12H,1-2H2;6*3H,2H2,1H3;6*1-2H2/t3-,4+,5-,6-;;;;;;;;;;;;/m1............/s1 |
CAS kayıt numarası |
56449-05-9 |
EINECS |
500-132-3 |
Moleküler Yapısı |
|
Kaynama noktası |
494.9°C at 760 mmHg |
Alevlenme noktası |
292.6°C |
Buhar basıncı |
7.22E-12mmHg at 25°C |
|