ChemNet > CAS > 623-98-3 Di-n-propyl sulphite
623-98-3 Di-n-propyl sulphite
Ürün Adı |
Di-n-propyl sulphite |
Moleküler Formülü |
C6H14O3S |
Molekül Ağırlığı |
166.23 |
InChI |
InChI=1/C6H14O3S/c1-3-5-8-10(7)9-6-4-2/h3-6H2,1-2H3 |
CAS kayıt numarası |
623-98-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.03 |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|