ChemNet > CAS > 6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
| Ürün Adı |
4,5-Dibromothiophene-2-carboxylic acid |
| Eş anlamlı |
4,5-Dibromothenoic acid |
| Moleküler Formülü |
C5H2Br2O2S |
| Molekül Ağırlığı |
285.9412 |
| InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
| CAS kayıt numarası |
6324-10-3 |
| EINECS |
228-683-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
2.309g/cm3 |
| Kaynama noktası |
367.1°C at 760 mmHg |
| Kırılma indisi |
1.682 |
| Alevlenme noktası |
175.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
