ChemNet > CAS > 6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
Ürün Adı |
4,5-Dibromothiophene-2-carboxylic acid |
Eş anlamlı |
4,5-Dibromothenoic acid |
Moleküler Formülü |
C5H2Br2O2S |
Molekül Ağırlığı |
285.9412 |
InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
CAS kayıt numarası |
6324-10-3 |
EINECS |
228-683-2 |
Moleküler Yapısı |
|
Yoğunluk |
2.309g/cm3 |
Kaynama noktası |
367.1°C at 760 mmHg |
Kırılma indisi |
1.682 |
Alevlenme noktası |
175.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|