CAS No: 63689-59-8, Chemical Name: 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione
the physical and chemical property of 63689-59-8, 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione is provided by ChemNet.com
ChemNet > CAS > 63689-59-8 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione
63689-59-8 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione
Ürün Adı |
1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-5,9-dione |
Eş anlamlı |
|
Moleküler Formülü |
C12H20O7S |
Molekül Ağırlığı |
308.348 |
InChI |
InChI=1/C12H20O7S/c13-11-9-17-10-12(14)19-4-2-16-6-8-20-7-5-15-1-3-18-11/h1-10H2 |
CAS kayıt numarası |
63689-59-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.154g/cm3 |
Kaynama noktası |
553.9°C at 760 mmHg |
Kırılma indisi |
1.45 |
Alevlenme noktası |
294.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|