ChemNet > CAS > 66085-00-5 izooktadekanoik asit, gliserol ile monoester
66085-00-5 izooktadekanoik asit, gliserol ile monoester
| Ürün Adı |
izooktadekanoik asit, gliserol ile monoester |
| Eş anlamlı |
Gliseril izostearat; Gliseril monoizostearat; İzoktadekanoik asit, 1,2,3-propantriol içeren monoester; Gliserol monoizostearat; İzostearik asit, 1,2,3-propaneriol ester (1:1); İzoktadekanoik asit, gliserol ile monoester; 2-hidroksi-1- (hidroksimetil) etil 16-metilheptadekanoat;
|
| ingilizce adı |
isooctadecanoic acid, monoester with glycerol; Glyceryl isostearate; Glyceryl monoisostearate; Isooctadecanoic acid, monoester with 1,2,3-propanetriol; Glycerol monoisostearate; Isostearic acid, 1,2,3-propaneriol ester (1:1); Isooctadecanoic acid, monoester with glycerol; 2-hydroxy-1-(hydroxymethyl)ethyl 16-methylheptadecanoate; Glyceryl lsostearate |
| Moleküler Formülü |
C21H42O4 |
| Molekül Ağırlığı |
358.5558 |
| InChI |
InChI=1/C21H42O4/c1-19(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-21(24)25-20(17-22)18-23/h19-20,22-23H,3-18H2,1-2H3 |
| CAS kayıt numarası |
66085-00-5 |
| EINECS |
266-124-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.957g/cm3 |
| Kaynama noktası |
481.5°C at 760 mmHg |
| Kırılma indisi |
1.468 |
| Alevlenme noktası |
153.8°C |
| Buhar basıncı |
2.7E-11mmHg at 25°C |
|