Ürün Adı |
l-Glutamik asit, N-koko asil türevleri, trietanolamin (1:1) ile birlikte |
Eş anlamlı |
L-Glutamik asit, N-coco asil türevleri, compds.trietanolamin ile; TEA-Cocoyl glutamat; Trietanolamin kokoil glutamat; N-Cocoyl-L-glutamik asit, mono (trietanolamin) tuzu; L-Glutamik asit, N-coco asil türevleri, compds.trietanolamin (1:1) ile; l-Glutamik asit, N-koko asil türevleri, trietanolamin ile birlikte (1: 1)
|
ingilizce adı |
l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine; TEA-Cocoyl glutamate; Triethanolamine cocoyl glutamate; N-Cocoyl-L-glutamic acid, mono(triethanolamine) salt; L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine(1:1); l-Glutamic acid,N-coco acyl derivs.,compds. with triethanolamine(1:1);
|
Moleküler Formülü |
C6H15NO3・C5H9NO4 |
Molekül Ağırlığı |
296.318 |
InChI |
InChI=1/C6H15NO3.C5H9NO4/c8-4-1-7(2-5-9)3-6-10;6-3(5(9)10)1-2-4(7)8/h8-10H,1-6H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
CAS kayıt numarası |
68187-29-1 |
EINECS |
269-084-6 |
Moleküler Yapısı |
|
|