CAS No: 74472-47-2, Chemical Name: 2,2',3,4,4',5,6-heptachlorobiphenyl
the physical and chemical property of 74472-47-2, 2,2',3,4,4',5,6-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 74472-47-2 2,2',3,4,4',5,6-heptachlorobiphenyl
74472-47-2 2,2',3,4,4',5,6-heptachlorobiphenyl
Ürün Adı |
2,2',3,4,4',5,6-heptachlorobiphenyl |
Eş anlamlı |
1,1'-biphenyl, 2,2',3,4,4',5,6-heptachloro-; 2,2',3,4,4',5,6-Heptachloro-1,1'-biphenyl; 2,2',3,4,4',5,6-PCB; 74472-47-2 |
Moleküler Formülü |
C12H3Cl7 |
Molekül Ağırlığı |
395.3232 |
InChI |
InChI=1/C12H3Cl7/c13-4-1-2-5(6(14)3-4)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
CAS kayıt numarası |
74472-47-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.658g/cm3 |
Kaynama noktası |
407.3°C at 760 mmHg |
Kırılma indisi |
1.632 |
Alevlenme noktası |
198.3°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|