ChemNet > CAS > 81868-12-4 5-Bromotryptamine hydrochloride
81868-12-4 5-Bromotryptamine hydrochloride
| Ürün Adı |
5-Bromotryptamine hydrochloride |
| Eş anlamlı |
2-(5-bromo-1H-indol-3-yl)ethanamine hydrochloride; 5-Bromotryptamine Hcl |
| Moleküler Formülü |
C10H12BrClN2 |
| Molekül Ağırlığı |
275.5727 |
| InChI |
InChI=1/C10H11BrN2.ClH/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10;/h1-2,5-6,13H,3-4,12H2;1H |
| CAS kayıt numarası |
81868-12-4 |
| Moleküler Yapısı |
|
| Kaynama noktası |
419.9°C at 760 mmHg |
| Alevlenme noktası |
207.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
