ChemNet > CAS > 836-41-9 N-(4-Methoxybenzylidene)aniline
836-41-9 N-(4-Methoxybenzylidene)aniline
Ürün Adı |
N-(4-Methoxybenzylidene)aniline |
Eş anlamlı |
p-Anisaldehyde anil~N-(4-Methoxybenzal)aniline; N-[(E)-(4-methoxyphenyl)methylidene]aniline |
Moleküler Formülü |
C14H13NO |
Molekül Ağırlığı |
211.2591 |
InChI |
InChI=1/C14H13NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-11H,1H3 |
CAS kayıt numarası |
836-41-9 |
EINECS |
212-647-8 |
Moleküler Yapısı |
|
Yoğunluk |
1g/cm3 |
Kaynama noktası |
339.002°C at 760 mmHg |
Kırılma indisi |
1.539 |
Alevlenme noktası |
129.557°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|