ChemNet > CAS > 836-41-9 N-(4-Methoxybenzylidene)aniline
836-41-9 N-(4-Methoxybenzylidene)aniline
| Ürün Adı |
N-(4-Methoxybenzylidene)aniline |
| Eş anlamlı |
p-Anisaldehyde anil~N-(4-Methoxybenzal)aniline; N-[(E)-(4-methoxyphenyl)methylidene]aniline |
| Moleküler Formülü |
C14H13NO |
| Molekül Ağırlığı |
211.2591 |
| InChI |
InChI=1/C14H13NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-11H,1H3 |
| CAS kayıt numarası |
836-41-9 |
| EINECS |
212-647-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1g/cm3 |
| Kaynama noktası |
339.002°C at 760 mmHg |
| Kırılma indisi |
1.539 |
| Alevlenme noktası |
129.557°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
