ChemNet > CAS > 95453-54-6 2,4-dimethyl-1,3-thiazole-5-carbaldehyde
95453-54-6 2,4-dimethyl-1,3-thiazole-5-carbaldehyde
| Ürün Adı |
2,4-dimethyl-1,3-thiazole-5-carbaldehyde |
| Eş anlamlı |
2,4-dimethylthiazole-5-carbaldehyde |
| Moleküler Formülü |
C6H7NOS |
| Molekül Ağırlığı |
141.1909 |
| InChI |
InChI=1/C6H7NOS/c1-4-6(3-8)9-5(2)7-4/h3H,1-2H3 |
| CAS kayıt numarası |
95453-54-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.213g/cm3 |
| Kaynama noktası |
238.884°C at 760 mmHg |
| Kırılma indisi |
1.588 |
| Alevlenme noktası |
98.274°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
