year
Category: | Pharmaceuticals and Biochemicals |
|
|
CAS NO: | 6537-80-0 | ||
EC NO: | |||
Molecular Formula: | C22H18O12 | ||
Molecular Weight: | 474.3711 | ||
Specification: | Cichoric acid 4% | ||
InChI: | InChI=1/C22H18O12/c23-13-5-1-11(9-15(13)25)3-7-17(27)33-19(21(29)30)20(22(31)32)34-18(28)8-4-12-2-6-14(24)16(26)10-12/h1-10,19-20,23-26H,(H,29,30)(H,31,32)/b7-3+,8-4+/t19-,20-/m0/s1 | ||
Packing: | 25kg/fiber drum I.D.42CM x H52CM | ||
Product description: -Product name:Echinacea purpurea extract powder Cichoric acid 4% -Brand: HUAKANG -Model: HK120041 -Latin name:Echinacea purpurea -Specification :Cichoric acid 4% -Test Method:HPLC Function: 1. Immune stimulator for colds and flus, sluggish immune systems 2. Inflammation, analgesic, sedative, anti-spasmodic 3. Relieve pain and swelling 4. Edema, water retention 5. Anti-viral 6. Infections, sore throats, UTI, strep throat; Eye and ear infections 7. Wound healing and cleansing 8. Anti-cancer 9. Snake and insect bites, scratches 10. Boils, abscesses, gangrene, ulcerations, sores 11. Tonsillitis, inflamed gums, mucus problems 12. Urticaria (external wash) 13. Antibiotic 14. Allergies 15. Stimulation of adrenal cortex, increase cortisol release
|
|||
Uses: | pharmaceutical, health food | ||
Synonyms: | (2R,3R)-2,3-bis[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-butanedioic acid;Dicaffeoyl tartaric acid;cichoric acid;Butanedioic acid, 2,3-bis((3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl)oxy)-, (R-(R*,R*))-;Chicoric acid;(2R,3R)-2,3-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid;(2S,3S)-2,3-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid;ChicoricAcid;Echinacea Herb Extract; | ||
Molecular Structure: |