Molecular Structure:

Product description: Name ： 2-Aminophenol another names ： C.I. 76520; C.I. Oxidation Base 17; 2-Amino-1-hydroxybenzene; 2-Hydroxyaniline; ortho amino phenol; o-Hydroxyaniline; O-Aminophenol; O-AMINO PHENOL; O-AMINOPHENOL; 2-Amino Phenol CAS NO： 95-55-6 EINECS NO： 202-431-1 Molecular formula ： C6H7NO Molecular weight ： 109.13 InChI： InChI=1/C6H7NO/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 Molecular structure ： Density ： 1.328 Melting point ： 172-177℃ Boiling point ： 164℃ (11 mmHg) Flashing point ： 168℃ Water solubility ： 17 g/L (20℃) Application ： Used as analytical reagent and diazo dye and sulfur dye intermediates