623-53-0 Methyl ethyl carbonate
| product Name |
Methyl ethyl carbonate |
| CAS No |
623-53-0 |
| Synonyms |
Carbonic acid ethyl methyl ester; Ethyl Methyl Carbonate; Carbonicacidethylmethylester; EMC; Ethoxyacetic acid,methyl ester |
| Molecular Formula |
C4H8O3 |
| Molecular Weight |
104.1045 |
| InChI |
InChI=1/C4H8O3/c1-3-7-4(5)6-2/h3H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.997g/cm3 |
| Boiling point |
107.5°C at 760 mmHg |
| Refractive index |
1.378 |
| Flash point |
26.7°C |
| Vapour Pressur |
27mmHg at 25°C |
|