ChemNet > CAS > 62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
| product Name |
Alpha,Alpha,2-Trichloro-6-fluorotoluene |
| Synonyms |
2-Chloro-6-fluorobenzalchloride; 1-chloro-2-(dichloromethyl)-3-fluorobenzene |
| Molecular Formula |
C7H4Cl3F |
| Molecular Weight |
213.4641 |
| InChI |
InChI=1/C7H4Cl3F/c8-4-2-1-3-5(11)6(4)7(9)10/h1-3,7H |
| CAS Registry Number |
62476-62-4 |
| EINECS |
263-562-8 |
| Molecular Structure |
|
| Density |
1.467g/cm3 |
| Boiling point |
225.4°C at 760 mmHg |
| Refractive index |
1.541 |
| Flash point |
99.7°C |
| Vapour Pressur |
0.129mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
