ChemNet > CAS > 6290-17-1 Ethyl acetoacetate propylene glycol ketal
6290-17-1 Ethyl acetoacetate propylene glycol ketal
| product Name |
Ethyl acetoacetate propylene glycol ketal |
| Synonyms |
2,4-Dimethyl-1,3-dioxolane-2-acetic acid ethyl ester~Ethyl 2,4-dimethyl-1,3-dioxolane-2-acetate; Acetoacetic acid ethyl ester 1,2-propylene ketal; ethyl (2,4-dimethyl-1,3-dioxolan-2-yl)acetate |
| Molecular Formula |
C9H16O4 |
| Molecular Weight |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-4-11-8(10)5-9(3)12-6-7(2)13-9/h7H,4-6H2,1-3H3 |
| CAS Registry Number |
6290-17-1 |
| EINECS |
228-536-2 |
| Molecular Structure |
|
| Density |
1.026g/cm3 |
| Boiling point |
220.6°C at 760 mmHg |
| Refractive index |
1.423 |
| Flash point |
86.8°C |
| Vapour Pressur |
0.112mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
