ChemNet > CAS > 1122-97-0 4-(Methylthio)thiophenol
1122-97-0 4-(Methylthio)thiophenol
उत्पाद का नाम |
4-(Methylthio)thiophenol |
समानार्थी |
4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol |
आणविक फार्मूला |
C7H8S2 |
आण्विक वजन |
156.2684 |
InChI |
InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
कैस रजिस्टी संख्या |
1122-97-0 |
आणविक संरचना |
|
घनत्व |
1.16g/cm3 |
उबलने का समय |
252.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.621 |
फ्लैश प्वाइंट |
106.7°C |
खतरा प्रतीक |
|
खतरे के कोड |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|