ChemNet > CAS > 1122-97-0 4-(Methylthio)thiophenol
1122-97-0 4-(Methylthio)thiophenol
| उत्पाद का नाम |
4-(Methylthio)thiophenol |
| अंग्रेजी नाम |
4-(Methylthio)thiophenol; 4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol; 4-Methylthio thiophenol |
| आणविक फार्मूला |
C7H8S2 |
| आण्विक वजन |
156.2684 |
| InChI |
InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| कैस रजिस्टी संख्या |
1122-97-0 |
| आणविक संरचना |
|
| घनत्व |
1.16g/cm3 |
| उबलने का समय |
252.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.621 |
| फ्लैश प्वाइंट |
106.7°C |
| वाष्प का दबाव |
0.03mmHg at 25°C |
| खतरे के कोड |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|