ChemNet > CAS > 116632-39-4 Bromoiodotoluene
116632-39-4 Bromoiodotoluene
Naam product |
Bromoiodotoluene |
Synoniemen |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
MF |
C7H6BrI |
Molecuulgewicht |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
CAS-nummer |
116632-39-4 |
Moleculaire Structuur |
|
Dichtheid |
2.062g/cm3 |
Kookpunt |
264.2°C at 760 mmHg |
Brekingsindex |
1.636 |
Vlampunt |
113.6°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|