ChemNet > CAS > 119795-57-2 1-chloro-4-(3-iodopropoxy)benzene
119795-57-2 1-chloro-4-(3-iodopropoxy)benzene
| Naam product |
1-chloro-4-(3-iodopropoxy)benzene |
| Engelse naam |
1-chloro-4-(3-iodopropoxy)benzene; |
| MF |
C9H10ClIO |
| Molecuulgewicht |
296.5326 |
| InChI |
InChI=1/C9H10ClIO/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5H,1,6-7H2 |
| CAS-nummer |
119795-57-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.673g/cm3 |
| Smeltpunt |
31℃ |
| Kookpunt |
317°C at 760 mmHg |
| Brekingsindex |
1.593 |
| Vlampunt |
145.5°C |
| Dampdruk |
0.000737mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|