ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
Naam product |
4,4'-Biphenyldicarbonitrile |
Synoniemen |
4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
MF |
C14H8N2 |
Molecuulgewicht |
204.2267 |
InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
CAS-nummer |
1591-30-6 |
EINECS |
216-468-6 |
Moleculaire Structuur |
|
Dichtheid |
1.2g/cm3 |
Smeltpunt |
236-236℃ |
Kookpunt |
403.5°C at 760 mmHg |
Brekingsindex |
1.631 |
Vlampunt |
199.2°C |
Gevaarsymbolen |
|
Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|