9003-53-6 Poly(styrene)
| product Name |
Poly(styrene) |
| CAS No |
9003-53-6 |
| Synonyms |
Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene |
| Molecular Formula |
C8H8 |
| Molecular Weight |
104.1491 |
| InChI |
InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
| Molecular Structure |
|
| Density |
1.047 |
| Boiling point |
212℃ |
| Refractive index |
1.5916 |
| Water solubility |
insoluble |
| Hazard Symbols |
Xi:;
|
| Risk Codes |
41:;
|
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Susan Xu |
| Telephone |
+86-573-83103233 |
| Email |
sales@jinhe-chem.com |
| Address |
2002,A Building, Yaocheng Plaza, No.1520, East Zhongshan RD Jiaxing City, Zhejiang Province£¬314000 China |
| Telephone |
+86-571-88086639 |
| Email |
info@star-chemicals.com |
| Address |
No. 810 Qinggong Building, No. 8 Wensan Road, Hangzhou, China |
| Contact |
sir |
| Telephone |
66026785050 |
| Email |
webmaster@tpigroup.co.th |
| Address |
26/56 TPI Tower, 26 Floor, Chan Tat Mai Road., Thungmahamek , Sathorn Bangkok 10120 THAILAND, , |
| Telephone |
+886-2-23923245 |
| Email |
admin@loyal.com.tw |
| Address |
19F, #85, Chung Hsiao E. Rd., Sec. 1, Taipei, Taiwan |
| Telephone |
+886-4-22794176 |
| Email |
ECC@enchuan.com.tw |
| Address |
676, Taiping Rd, Taiping City, Taichung Hsien. 411. Taiwan. |