Details for 2-Chloro-5-nitrobenzoic acid

2-Chloro-5-nitrobenzoic acid
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2516-96-3 |
EC NO: |
219-739-7 |
Molecular Formula: |
C7H3ClNO4 |
Molecular Weight: |
200.5566 |
Specification: |
99.5% |
InChI: |
InChI=1/C7H4ClNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
5-nitro-2-chlorobenzoic acid;2-chloro-5-nitrobenzoate;2-chloro-5-nitro benzoic acid; |
Molecular Structure: |
 |
if you are sourcing 2-Chloro-5-nitrobenzoic acid from China ,just feel free to inquire