Details for 3,5-Dinitro-4-chlorobenzoic acid

3,5-Dinitro-4-chlorobenzoic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
118-97-8 |
| EC NO: |
204-290-1 |
| Molecular Formula: |
C7H2ClN2O6 |
| Molecular Weight: |
245.5541 |
| Specification: |
99% |
| InChI: |
InChI=1/C7H3ClN2O6/c8-6-4(9(13)14)1-3(7(11)12)2-5(6)10(15)16/h1-2H,(H,11,12)/p-1 |
| Packing: |
25kg/drum |
| Uses: |
Intermediate of organic synthesis |
| Synonyms: |
3,5-Dinitro-4-Chloro Benzoic Acid;4-C-3,5-DNBA;
;4-chloro-3,5-dinitrobenzoate; |
| Molecular Structure: |
 |
if you are sourcing 3,5-Dinitro-4-chlorobenzoic acid from China ,just feel free to inquire