Details for 3-Methyl-2-aminobenzoic acid

3-Methyl-2-aminobenzoic acid
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
4389-45-1 |
EC NO: |
224-505-2 |
Molecular Formula: |
C8H9NO2 |
Molecular Weight: |
151.1626 |
Specification: |
99% |
InChI: |
InChI=1/C8H9NO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
3-Methylanthranilic acid;3-Methyl-2-Amino Benzoic Acid;2-Amino-3-Methybenzoic Acid;2-Aminobenzoic-3-methyl acid; |
Molecular Structure: |
 |
if you are sourcing 3-Methyl-2-aminobenzoic acid from China ,just feel free to inquire