Details for 4-Chloro-3-nitrobenzamide

4-Chloro-3-nitrobenzamide
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
16588-06-0 |
| EC NO: |
240-644-1 |
| Molecular Formula: |
C7H5ClN2O3 |
| Molecular Weight: |
200.5792 |
| Specification: |
98% |
| InChI: |
InChI=1/C7H5ClN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
| Packing: |
25kg/drum |
| Uses: |
Intermediate of organic synthesis |
| Synonyms: |
Benzamide, 4-chloro-3-nitro-;3-Nitro-4-chlorobenzamide;4-09-00-01227 (Beilstein Handbook Reference);4-Chlor-3-nitrobenzamid;4-Chlor-3-nitrobenzamid [Czech];BRN 0645210;NSC 127825 |
| Molecular Structure: |
 |
if you are sourcing 4-Chloro-3-nitrobenzamide from China ,just feel free to inquire