Details for 5-Aminoisophthalic acid monomethyl ester

5-Aminoisophthalic acid monomethyl ester
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
28179-47-7 |
EC NO: |
|
Molecular Formula: |
C9H9NO4 |
Molecular Weight: |
195.1721 |
Specification: |
98% |
InChI: |
InChI=1/C9H9NO4/c1-14-9(13)6-2-5(8(11)12)3-7(10)4-6/h2-4H,10H2,1H3,(H,11,12) |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
5-Aminoisophthalic acid monomethyl ester;3-amino-5-(methoxycarbonyl)benzoic acid; |
Molecular Structure: |
 |
if you are sourcing 5-Aminoisophthalic acid monomethyl ester from China ,just feel free to inquire