Details for Dimethyl 2-aminobenzene-1,4-dicarboxylate

Dimethyl 2-aminobenzene-1,4-dicarboxylate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
5372-81-6 |
EC NO: |
226-364-2 |
Molecular Formula: |
C10H11NO4 |
Molecular Weight: |
209.1986 |
Specification: |
98.5% |
InChI: |
InChI=1/C10H11NO4/c1-14-9(12)6-3-4-7(8(11)5-6)10(13)15-2/h3-5H,11H2,1-2H3 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
Aminoterephthalic acid dimethyl ester;Amino Tere Phthalate dimethyl ESter;dimethyl 2-aminobenzene-1,4-dicarboxylate;2-Aminoterephthalic Acid Dimethyl Ester;1,4-dimethyl 2-aminobenzene-1,4-dicarboxylate; |
Molecular Structure: |
 |
if you are sourcing Dimethyl 2-aminobenzene-1,4-dicarboxylate from China ,just feel free to inquire