Details for Dimethyl 4-aminophthalate

Dimethyl 4-aminophthalate
Category: |
Intermediates |
|
CAS NO: |
51832-31-6 |
EC NO: |
257-460-2 |
Molecular Formula: |
C10H11NO4 |
Molecular Weight: |
209.1986 |
Specification: |
98% |
InChI: |
InChI=1/C10H11NO4/c1-14-9(12)7-4-3-6(11)5-8(7)10(13)15-2/h3-5H,11H2,1-2H3 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
Dimethyl 4-aminophthalate;AI3-14780;1,2-Benzenedicarboxylic acid, 4-amino-, dimethyl ester;dimethyl 4-aminobenzene-1,2-dicarboxylate; |
Molecular Structure: |
 |
if you are sourcing Dimethyl 4-aminophthalate from China ,just feel free to inquire