Details for Methyl 3,4-diaminobenzoate

Methyl 3,4-diaminobenzoate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
36692-49-6 |
EC NO: |
|
Molecular Formula: |
C8H6Br2O2 |
Molecular Weight: |
293.94 |
Specification: |
98% |
InChI: |
InChI=1/C8H6Br2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
Packing: |
25kg/drum |
Uses: |
Intermediate of organic synthesis |
Synonyms: |
Methyldibromobenzoate;3,4-Diaminobenzoic acid methyl ester;methyl 2,5-dibromobenzoate;3,4-Diamino-Benzoic Acid Methyl Ester; |
Molecular Structure: |
 |
if you are sourcing Methyl 3,4-diaminobenzoate from China ,just feel free to inquire