Details for Phthalic acid dimethyl ester

Phthalic acid dimethyl ester
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
131-11-3 |
| EC NO: |
205-011-6 |
| Molecular Formula: |
C10H10O4 |
| Molecular Weight: |
194.19 |
| Specification: |
99.5% |
| InChI: |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
| Packing: |
25kg/drum |
| Uses: |
Intermediate of organic synthesis |
| Synonyms: |
Dimethyl 1,2-benzenedicarboxylate;D.M.P;Phthalic acid dimethyl ester;Benzene-1,2-dicarboxylic acid dimethyl ester;1,2-benzenedicarboxylic acid dimethyl ester;DMP;Dimethyl phthalate (DMP); |
| Molecular Structure: |
 |
if you are sourcing Phthalic acid dimethyl ester from China ,just feel free to inquire