Details for Phthalic acid dimethyl ester

 
Phthalic acid dimethyl ester
 
      
        | Category: | 
        Organic chemicals and Derivatives | 
        
        	 | 
      
      
        | CAS NO: | 
      131-11-3   | 
      
      
        | EC NO: | 
        
        205-011-6 | 
      
      
        | Molecular Formula: | 
        
        C10H10O4 | 
      
					
					  | Molecular Weight: | 
                      194.19 | 
					
                    
                      | Specification: | 
                      99.5%	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 | 
                    
                    
                      | Packing: | 
                      25kg/drum | 
                    
                    
                    
                      | Uses: | 
                      
                      Intermediate of organic synthesis | 
                    
                    
                    
                      | Synonyms: | 
                      
                      Dimethyl 1,2-benzenedicarboxylate;D.M.P;Phthalic acid dimethyl ester;Benzene-1,2-dicarboxylic acid dimethyl ester;1,2-benzenedicarboxylic acid dimethyl ester;DMP;Dimethyl phthalate (DMP); | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  Phthalic acid dimethyl ester from  China ,just feel free to inquire