Details for 4'-Bromomethylbiphenyl-2-carboxylic acid methyl ester

4'-Bromomethylbiphenyl-2-carboxylic acid methyl ester
| Category: |
Intermediates |
|
| CAS NO: |
114772-34-8 |
| EC NO: |
|
| Molecular Formula: |
C15H14O2 |
| Molecular Weight: |
226.2705 |
| Specification: |
|
| InChI: |
InChI=1/C15H14O2/c1-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15(16)17-2/h3-10H,1-2H3 |
| Synonyms: |
methyl 4'-methylbiphenyl-2-carboxylate;4'-methylbiphenyl-2-carboxylic acid methyl ester;Methyl-4-methyl-biphenyl 2-carboxylate;4-Methyl Biphenyl-2-Carboxylate;Methyl-4-methylbiphenyl-2-carboxylate; |
| Molecular Structure: |
 |
if you are sourcing 4'-Bromomethylbiphenyl-2-carboxylic acid methyl ester from China ,just feel free to inquire