Details for Benzyl chloroformate

Benzyl chloroformate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
501-53-1 |
| EC NO: |
207-925-0 |
| Molecular Formula: |
C8H7ClO2 |
| Molecular Weight: |
170.59 |
| Specification: |
|
| InChI: |
InChI=1/C8H7ClO2/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| Synonyms: |
benzyl chlorocarbonate;BENZYL CHLOROFORMATE (BCF);carbobenzoxy chloride;Carbonochloridic acid, phenylmethyl ester;Carbonochloride acid benzylester;Z-Cl;Carboobenzoxy Chloride;Benzyl Chloroformate,Carboobenzoxy Chloride;Cbz-Cl; |
| Molecular Structure: |
 |
if you are sourcing Benzyl chloroformate from China ,just feel free to inquire