Details for Benzyl chloroformate

 
Benzyl chloroformate
 
      
        | Category: | 
        Pharmaceuticals and Biochemicals | 
        
        	 | 
      
      
        | CAS NO: | 
      501-53-1   | 
      
      
        | EC NO: | 
        
        207-925-0 | 
      
      
        | Molecular Formula: | 
        
        C8H7ClO2 | 
      
					
					  | Molecular Weight: | 
                      170.59 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C8H7ClO2/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      benzyl chlorocarbonate;BENZYL CHLOROFORMATE (BCF);carbobenzoxy chloride;Carbonochloridic acid, phenylmethyl ester;Carbonochloride acid benzylester;Z-Cl;Carboobenzoxy Chloride;Benzyl Chloroformate,Carboobenzoxy Chloride;Cbz-Cl; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  Benzyl chloroformate from  China ,just feel free to inquire