Details for Methyl 3-oxovalerate

Methyl 3-oxovalerate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
30414-53-0 |
| EC NO: |
250-184-3 |
| Molecular Formula: |
C6H10O3 |
| Molecular Weight: |
130.1418 |
| Specification: |
|
| InChI: |
InChI=1/C6H10O3/c1-3-5(7)4-6(8)9-2/h3-4H2,1-2H3 |
| Synonyms: |
methyl-3-oxo pentanoate;Methyl 3-oxovalerate;Methyl,1,3-oxovalerate;METHYL PROPIONYLACETATE;Methyl 3-oxo-pentanoate;methyl propionyl acetate;Methyl 3-oxo pentanoate; |
| Molecular Structure: |
 |
if you are sourcing Methyl 3-oxovalerate from China ,just feel free to inquire