Details for Methyl 5-bromo-1H-pyrrole-2-carboxylate

Methyl 5-bromo-1H-pyrrole-2-carboxylate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
934-07-6 |
| EC NO: |
|
| Molecular Formula: |
C6H6BrNO2 |
| Molecular Weight: |
204.0213 |
| Specification: |
|
| InChI: |
InChI=1/C6H6BrNO2/c1-10-6(9)4-2-3-5(7)8-4/h2-3,8H,1H3 |
| Synonyms: |
1H-pyrrole-2-carboxylic acid, 5-bromo-, methyl ester;1H-Pyrrole-2-carboxylic acid, 5-bromo,methyl ester; |
| Molecular Structure: |
 |
if you are sourcing Methyl 5-bromo-1H-pyrrole-2-carboxylate from China ,just feel free to inquire