Details for Methyl 5-chloro-2-methylnicotinate

Methyl 5-chloro-2-methylnicotinate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
350597-49-8 |
| EC NO: |
|
| Molecular Formula: |
C8H8ClNO2 |
| Molecular Weight: |
185.6076 |
| Specification: |
|
| InChI: |
InChI=1/C8H8ClNO2/c1-5-7(8(11)12-2)3-6(9)4-10-5/h3-4H,1-2H3 |
| Synonyms: |
3-Pyridinecarboxylic acid, 5-chloro-2-methyl-, methyl ester;methyl 5-chloro-2-methylpyridine-3-carboxylate; |
| Molecular Structure: |
 |
if you are sourcing Methyl 5-chloro-2-methylnicotinate from China ,just feel free to inquire